Difference between revisions of "Ec-14 006720"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2541 RXN-2541] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] == * smiles: ** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2541 RXN-2541] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.5.1.115 EC-2.5.1.115]
+
** InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N
 +
* common name:
 +
** linustatin
 +
* molecular weight:
 +
** 409.389   
 
* Synonym(s):
 
* Synonym(s):
 +
** propanenitrile
 +
** [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-13602]]
−
** 1 [[HOMOGENTISATE]][c] '''+''' 1 [[PHYTYL-PYROPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[MPBQ]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 homogentisate[c] '''+''' 1 phytyl diphosphate[c] '''+''' 1 H+[c] '''=>''' 1 2-methyl-6-phytyl-1,4-benzoquinol[c] '''+''' 1 diphosphate[c] '''+''' 1 CO2[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-21_000990]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-1422]], vitamin E biosynthesis (tocopherols): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1422 PWY-1422]
+
−
** '''7''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* LIGAND-CPD:
−
** [http://www.genome.jp/dbget-bin/www_bget?R07500 R07500]
+
** [http://www.genome.jp/dbget-bin/www_bget?C08333 C08333]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-2.5.1.115}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6483 6483]
−
{{#set: gene associated=Ec-21_000990}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY-1422}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119301 119301]
−
{{#set: reconstruction category=orthology|annotation}}
+
{{#set: smiles=CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
{{#set: inchi key=InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N}}
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: common name=linustatin}}
 +
{{#set: molecular weight=409.389    }}
 +
{{#set: common name=propanenitrile|[2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]}}
 +
{{#set: consumed by=RXN-13602}}

Revision as of 13:51, 21 March 2018

Metabolite CPD-14594

  • smiles:
    • CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
  • inchi key:
    • InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N
  • common name:
    • linustatin
  • molecular weight:
    • 409.389
  • Synonym(s):
    • propanenitrile
    • [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_006720&oldid=22218"