Difference between revisions of "Ec-11 006270"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-06_005470 == * left end position: ** 4347324 * transcription direction: ** NEGATIVE * right end position: ** 4348532 * centisome position: ** 49.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11444 CPD-11444] == * smiles: ** C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11444 CPD-11444] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5)) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F |
− | * | + | * common name: |
− | ** | + | ** uroporphyrinogen-I |
− | * | + | * molecular weight: |
− | ** | + | ** 828.742 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** uroporphyrinogen I |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-14396]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-10642]] | |
− | + | ||
− | + | ||
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201940 25201940] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.389644.html 389644] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62626 62626] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05766 C05766] | ||
+ | * HMDB : HMDB02211 | ||
+ | {{#set: smiles=C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))}} | ||
+ | {{#set: inchi key=InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F}} | ||
+ | {{#set: common name=uroporphyrinogen-I}} | ||
+ | {{#set: molecular weight=828.742 }} | ||
+ | {{#set: common name=uroporphyrinogen I}} | ||
+ | {{#set: produced by=RXN-14396}} | ||
+ | {{#set: reversible reaction associated=RXN-10642}} |
Revision as of 14:51, 21 March 2018
Contents
Metabolite CPD-11444
- smiles:
- C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))
- inchi key:
- InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F
- common name:
- uroporphyrinogen-I
- molecular weight:
- 828.742
- Synonym(s):
- uroporphyrinogen I
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))" cannot be used as a page name in this wiki.