Difference between revisions of "ALLANTOATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * inchi key: ** InChIKey=YDBYJHTYSH...")
(Created page with "Category:Gene == Gene Ec-01_005740 == * left end position: ** 4983791 * transcription direction: ** NEGATIVE * right end position: ** 4994540 * centisome position: ** 48.2...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] ==
+
== Gene Ec-01_005740 ==
−
* smiles:
+
* left end position:
−
** C[S+](CCC([N+])C(=O)[O-])C
+
** 4983791
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** S-methyl-L-methionine
+
** 4994540
−
* molecular weight:
+
* centisome position:
−
** 164.242    
+
** 48.298004    
 
* Synonym(s):
 
* Synonym(s):
−
** S-methylmethionine
+
** Esi_0392_0017
 +
** Esi0392_0017
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[MMUM-RXN]]
+
* Reaction: [[3.4.25.1-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4983791}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098638 7098638]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=4994540}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58252 58252]
+
{{#set: centisome position=48.298004   }}
−
* BIGG : 41336
+
{{#set: common name=Esi_0392_0017|Esi0392_0017}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.4.25.1-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03172 C03172]
+
−
{{#set: smiles=C[S+](CCC([N+])C(=O)[O-])C}}
+
−
{{#set: inchi key=InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O}}
+
−
{{#set: common name=S-methyl-L-methionine}}
+
−
{{#set: molecular weight=164.242   }}
+
−
{{#set: common name=S-methylmethionine}}
+
−
{{#set: consumed by=MMUM-RXN}}
+

Revision as of 13:51, 21 March 2018

Gene Ec-01_005740

  • left end position:
    • 4983791
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4994540
  • centisome position:
    • 48.298004
  • Synonym(s):
    • Esi_0392_0017
    • Esi0392_0017

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ALLANTOATE&oldid=22290"