Difference between revisions of "Ec-01 000090"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_006720 == * left end position: ** 6201803 * transcription direction: ** NEGATIVE * right end position: ** 6212659 * centisome position: ** 94.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * smiles: ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) * inchi key: ** I...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == |
− | * | + | * smiles: |
− | ** | + | ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=JZRWCGZRTZMZEH-UHFFFAOYSA-N |
− | * | + | * common name: |
− | ** | + | ** thiamine |
− | * | + | * molecular weight: |
− | ** | + | ** 265.352 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** thiamin |
− | ** | + | ** vitamin B1 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[THIAMIN-PYROPHOSPHOKINASE-RXN]] |
− | * | + | * [[TransportSeed_THIAMINE]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[TransportSeed_THIAMINE]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
+ | * [[ExchangeSeed_THIAMINE]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 67-03-8 |
− | {{#set: | + | * CAS : 59-43-8 |
− | {{#set: | + | * BIGG : 34804 |
− | {{#set: | + | * DRUGBANK : DB00152 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1130 1130] |
− | {{#set: | + | * HMDB : HMDB00235 |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00378 C00378] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.1098.html 1098] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18385 18385] | ||
+ | * METABOLIGHTS : MTBLC18385 | ||
+ | {{#set: smiles=CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2))}} | ||
+ | {{#set: inchi key=InChIKey=JZRWCGZRTZMZEH-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=thiamine}} | ||
+ | {{#set: molecular weight=265.352 }} | ||
+ | {{#set: common name=thiamin|vitamin B1}} | ||
+ | {{#set: consumed by=THIAMIN-PYROPHOSPHOKINASE-RXN|TransportSeed_THIAMINE}} | ||
+ | {{#set: produced by=TransportSeed_THIAMINE}} | ||
+ | {{#set: reversible reaction associated=ExchangeSeed_THIAMINE}} |
Revision as of 14:51, 21 March 2018
Contents
Metabolite THIAMINE
- smiles:
- CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2))
- inchi key:
- InChIKey=JZRWCGZRTZMZEH-UHFFFAOYSA-N
- common name:
- thiamine
- molecular weight:
- 265.352
- Synonym(s):
- thiamin
- vitamin B1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 67-03-8
- CAS : 59-43-8
- BIGG : 34804
- DRUGBANK : DB00152
- PUBCHEM:
- HMDB : HMDB00235
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC18385
"CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2))" cannot be used as a page name in this wiki.