Difference between revisions of "Ec-01 005280"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C(C)=C(C)C=1O)O))C)C * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-28_000490 == * left end position: ** 496490 * transcription direction: ** POSITIVE * right end position: ** 500889 * centisome position: ** 13.103...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-28_000490 == |
− | * | + | * left end position: |
− | ** | + | ** 496490 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 500889 |
− | * | + | * centisome position: |
− | ** | + | ** 13.103388 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0098_0002 | ||
+ | ** Esi0098_0002 | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-15556]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=496490}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=500889}} | |
− | + | {{#set: centisome position=13.103388 }} | |
− | + | {{#set: common name=Esi_0098_0002|Esi0098_0002}} | |
− | + | {{#set: reaction associated=RXN-15556}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:52, 21 March 2018
Gene Ec-28_000490
- left end position:
- 496490
- transcription direction:
- POSITIVE
- right end position:
- 500889
- centisome position:
- 13.103388
- Synonym(s):
- Esi_0098_0002
- Esi0098_0002
Reactions associated
- Reaction: RXN-15556
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome