Difference between revisions of "HISTIDINE-AMMONIA-LYASE-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-11_002460 == * left end position: ** 2587222 * transcription direction: ** POSITIVE * right end position: ** 2592123 * centisome position: ** 41.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M |
− | * | + | * common name: |
− | ** | + | ** delphinidin-3-O-β-D-glucoside |
− | * | + | * molecular weight: |
− | ** | + | ** 463.374 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** delfinidin-3-O-glucoside |
− | + | ||
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-8228]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMPK12010278 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=165559 165559] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31463 31463] |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C12138 C12138] |
+ | * HMDB : HMDB37997 | ||
+ | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))}} | ||
+ | {{#set: inchi key=InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M}} | ||
+ | {{#set: common name=delphinidin-3-O-β-D-glucoside}} | ||
+ | {{#set: molecular weight=463.374 }} | ||
+ | {{#set: common name=delfinidin-3-O-glucoside}} | ||
+ | {{#set: consumed by=RXN-8228}} |
Revision as of 13:52, 21 March 2018
Contents
Metabolite CPD-7117
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))
- inchi key:
- InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M
- common name:
- delphinidin-3-O-β-D-glucoside
- molecular weight:
- 463.374
- Synonym(s):
- delfinidin-3-O-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))" cannot be used as a page name in this wiki.