Difference between revisions of "SINAPYL-ALCOHOL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1106 RXN-1106] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == * smiles: ** CC(C(C(=O)[O-])=CC(=O)[O-])C * inchi key: ** InChIKey=NJMGRJ...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1106 RXN-1106] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C(C(=O)[O-])=CC(=O)[O-])C
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/1.2.1.44 EC-1.2.1.44]
+
** InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L
 +
* common name:
 +
** 2-isopropylmaleate
 +
* molecular weight:
 +
** 156.138   
 
* Synonym(s):
 
* Synonym(s):
 +
** β-isopropylmaleate
 +
** 2-isopropylmaleic acid
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[FERULOYL-COA]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CONIFERYL-ALDEHYDE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) of unknown directionality ==
* With common name(s):
+
* [[3-ISOPROPYLMALISOM-RXN]]
** 1 feruloyl-CoA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 coniferaldehyde[c] '''+''' 1 coenzyme A[c] '''+''' 1 NADP+[c]
+
* [[RXN-8991]]
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-12_005240]]
+
** [[pantograph]]-[[aragem]]
+
* [[Ec-23_001220]]
+
** [[pantograph]]-[[aragem]]
+
* [[Ec-12_001350]]
+
** [[pantograph]]-[[aragem]]
+
== Pathways  ==
+
* [[PWY-6027]], capsiconiate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6027 PWY-6027]
+
** '''1''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-361]], phenylpropanoid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-361 PWY-361]
+
** '''7''' reactions found over '''15''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-aragem]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R02193 R02193]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21954611 21954611]
{{#set: direction=LEFT-TO-RIGHT}}
+
* HMDB : HMDB12241
{{#set: ec number=EC-1.2.1.44}}
+
* LIGAND-CPD:
{{#set: gene associated=Ec-12_005240|Ec-23_001220|Ec-12_001350}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02631 C02631]
{{#set: in pathway=PWY-6027|PWY-361}}
+
* CHEMSPIDER:
{{#set: reconstruction category=orthology}}
+
** [http://www.chemspider.com/Chemical-Structure.10710392.html 10710392]
{{#set: reconstruction source=orthology-aragem}}
+
* CHEBI:
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58085 58085]
 +
* BIGG : 40241
 +
{{#set: smiles=CC(C(C(=O)[O-])=CC(=O)[O-])C}}
 +
{{#set: inchi key=InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L}}
 +
{{#set: common name=2-isopropylmaleate}}
 +
{{#set: molecular weight=156.138    }}
 +
{{#set: common name=β-isopropylmaleate|2-isopropylmaleic acid}}
 +
{{#set: reversible reaction associated=3-ISOPROPYLMALISOM-RXN|RXN-8991}}

Revision as of 13:52, 21 March 2018

Metabolite CPD-9451

  • smiles:
    • CC(C(C(=O)[O-])=CC(=O)[O-])C
  • inchi key:
    • InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L
  • common name:
    • 2-isopropylmaleate
  • molecular weight:
    • 156.138
  • Synonym(s):
    • β-isopropylmaleate
    • 2-isopropylmaleic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C(C(=O)[O-])=CC(=O)[O-])C" cannot be used as a page name in this wiki.