Difference between revisions of "CPD-17815"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-phospho-L-seryl-tRNASecs O-phospho-L-seryl-tRNASecs] == * common name: ** an O-phospho-L-sery...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == |
| + | * smiles: | ||
| + | ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O | ||
| + | * inchi key: | ||
| + | ** InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** 1-oleyl-2-lyso-phosphatidate |
| + | * molecular weight: | ||
| + | ** 434.509 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-2-lysophosphatidate |
| − | ** | + | ** lysophosphatidic acid |
| − | ** | + | ** LPA |
| + | ** oleoyl lysophosphatidic acid | ||
| + | ** 1-oleoyl-lyso-phosphatidic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15043]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15045]] | ||
| + | * [[RXN-15046]] | ||
| + | * [[RXN-15068]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173225 46173225] |
| − | {{#set: consumed by=RXN- | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74544 74544] |
| + | * METABOLIGHTS : MTBLC74544 | ||
| + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O}} | ||
| + | {{#set: inchi key=InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L}} | ||
| + | {{#set: common name=1-oleyl-2-lyso-phosphatidate}} | ||
| + | {{#set: molecular weight=434.509 }} | ||
| + | {{#set: common name=L-2-lysophosphatidate|lysophosphatidic acid|LPA|oleoyl lysophosphatidic acid|1-oleoyl-lyso-phosphatidic acid}} | ||
| + | {{#set: consumed by=RXN-15043}} | ||
| + | {{#set: produced by=RXN-15045|RXN-15046|RXN-15068}} | ||
Revision as of 13:52, 21 March 2018
Contents
Metabolite L-1-LYSOPHOSPHATIDATE
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
- inchi key:
- InChIKey=WRGQSWVCFNIUNZ-GDCKJWNLSA-L
- common name:
- 1-oleyl-2-lyso-phosphatidate
- molecular weight:
- 434.509
- Synonym(s):
- L-2-lysophosphatidate
- lysophosphatidic acid
- LPA
- oleoyl lysophosphatidic acid
- 1-oleoyl-lyso-phosphatidic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.
