Difference between revisions of "Ec-08 004800"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TDP TDP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])OP(=O)([O-])[O-])O2)) * in...") |
(Created page with "Category:Gene == Gene Ec-01_006670 == * left end position: ** 5737688 * transcription direction: ** POSITIVE * right end position: ** 5741349 * centisome position: ** 55.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_006670 == |
− | * | + | * left end position: |
− | ** | + | ** 5737688 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5741349 |
− | * | + | * centisome position: |
− | ** | + | ** 55.604034 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0002_0273 |
− | ** | + | ** Esi0002_0273 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[FADSYN-RXN]] |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
− | + | * [[PWY66-366]] | |
− | * [[ | + | * [[PWY-6167]] |
+ | * [[PWY-6168]] | ||
+ | * [[RIBOSYN2-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5737688}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5741349}} | |
− | + | {{#set: centisome position=55.604034 }} | |
− | + | {{#set: common name=Esi_0002_0273|Esi0002_0273}} | |
− | + | {{#set: reaction associated=FADSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY66-366|PWY-6167|PWY-6168|RIBOSYN2-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:52, 21 March 2018
Gene Ec-01_006670
- left end position:
- 5737688
- transcription direction:
- POSITIVE
- right end position:
- 5741349
- centisome position:
- 55.604034
- Synonym(s):
- Esi_0002_0273
- Esi0002_0273
Reactions associated
- Reaction: FADSYN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome