Difference between revisions of "Ec-27 000390"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-09_000360 == * left end position: ** 385111 * transcription direction: ** POSITIVE * right end position: ** 385848 * centisome position: ** 6.8608...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-09_000360 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] ==
−
* left end position:
+
* smiles:
−
** 385111
+
** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
−
* right end position:
+
* common name:
−
** 385848
+
** 14-hydroxylanosterol
−
* centisome position:
+
* molecular weight:
−
** 6.860858    
+
** 442.724    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0135_0019
+
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
−
** Esi0135_0019
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
+
* [[RXN66-304]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
* [[RXN66-303]]
−
* [[RXN-17203]]
+
== Reaction(s) of unknown directionality ==
−
** esiliculosus_genome
+
−
***go-term
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=385111}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935]
−
{{#set: right end position=385848}}
+
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
−
{{#set: centisome position=6.860858   }}
+
{{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}}
−
{{#set: common name=Esi_0135_0019|Esi0135_0019}}
+
{{#set: common name=14-hydroxylanosterol}}
−
{{#set: reaction associated=GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN|RXN-17203}}
+
{{#set: molecular weight=442.724   }}
 +
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol}}
 +
{{#set: consumed by=RXN66-304}}
 +
{{#set: produced by=RXN66-303}}

Revision as of 13:53, 21 March 2018

Metabolite CPD-4568

  • smiles:
    • CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
  • inchi key:
    • InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
  • common name:
    • 14-hydroxylanosterol
  • molecular weight:
    • 442.724
  • Synonym(s):
    • 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_000390&oldid=22472"