Difference between revisions of "RXN-8975"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == * smiles: ** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Ec-14_001520 == * Synonym(s): ** Esi_0182_0018 ** Esi0182_0018 == Reactions associated == * Reaction: RXN-1884 ** Source: orthology-aragem =...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] ==
+
== Gene Ec-14_001520 ==
* smiles:
+
** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O
+
* inchi key:
+
** InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L
+
* common name:
+
** keto-D-ribose 5-phosphate
+
* molecular weight:
+
** 228.095   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0182_0018
 +
** Esi0182_0018
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-1884]]
* [[RXN-15346]]
+
** Source: [[orthology-aragem]]
* [[RXN-14997]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
* [[PWY-882]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0182_0018|Esi0182_0018}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21115541 21115541]
+
{{#set: reaction associated=RXN-1884}}
* CHEBI:
+
{{#set: pathway associated=PWY-882}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58273 58273]
+
{{#set: smiles=[CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O}}
+
{{#set: inchi key=InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L}}
+
{{#set: common name=keto-D-ribose 5-phosphate}}
+
{{#set: molecular weight=228.095    }}
+
{{#set: produced by=RXN-15346|RXN-14997}}
+

Revision as of 13:53, 21 March 2018

Gene Ec-14_001520

  • Synonym(s):
    • Esi_0182_0018
    • Esi0182_0018

Reactions associated

Pathways associated

External links