Difference between revisions of "Ec-24 000030"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7719 RXN-7719] == * direction: ** REVERSIBLE * common name: ** dihydrolipoamide dehydrogenase *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7719 RXN-7719] ==
−
* smiles:
+
* direction:
−
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
+
 
* common name:
 
* common name:
−
** campest-4-en-3-one
+
** dihydrolipoamide dehydrogenase
−
* molecular weight:
+
** Branched chain alpha-keto acid dehydrogenase E1 beta subunit
−
** 398.671   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.8.1.4 EC-1.8.1.4]
 
* Synonym(s):
 
* Synonym(s):
−
** methylcholestenone
 
−
** (24R)-24-methyl-cholest-4-en-3-one
 
−
** 3-dehydro-Δ4-5-campesterol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-711]]
+
* With identifiers:
−
* [[RXN-4231]]
+
** 1 [[NAD]][c] '''+''' 1 [[BCAA-dehydrogenase-DH-lipoyl]][c] '''<=>''' 1 [[BCAA-dehydrogenase-lipoyl]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NAD+[c] '''+''' 1 an [apo BCAA dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine[c] '''<=>''' 1 an [apo BCAA dehydrogenase E2 protein] N6-lipoyl-L-lysine[c] '''+''' 1 NADH[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-06_009010]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-27_004160]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-25_000020]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5046]], 2-oxoisovalerate decarboxylation to isobutanoyl-CoA: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5046 PWY-5046]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200612 25200612]
+
{{#set: common name=dihydrolipoamide dehydrogenase}}
−
* LIGAND-CPD:
+
{{#set: common name=Branched chain alpha-keto acid dehydrogenase E1 beta subunit}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785]
+
{{#set: ec number=EC-1.8.1.4}}
−
* HMDB : HMDB12196
+
{{#set: gene associated=Ec-06_009010|Ec-27_004160|Ec-25_000020}}
−
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: in pathway=PWY-5046}}
−
{{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=campest-4-en-3-one}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: molecular weight=398.671    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-&Delta;4-5-campesterol}}
+
−
{{#set: consumed by=RXN-711|RXN-4231}}
+

Revision as of 13:53, 21 March 2018

Reaction RXN-7719

  • direction:
    • REVERSIBLE
  • common name:
    • dihydrolipoamide dehydrogenase
    • Branched chain alpha-keto acid dehydrogenase E1 beta subunit
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5046, 2-oxoisovalerate decarboxylation to isobutanoyl-CoA: PWY-5046
    • 3 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-24_000030&oldid=22495"