Difference between revisions of "Ec-20 004730"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-14_001520 == * Synonym(s): ** Esi_0182_0018 ** Esi0182_0018 == Reactions associated == * RXN-1884 ** pantograph-aragem == Pathways as...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-14_001520 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
 +
* smiles:
 +
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
 +
* common name:
 +
** campest-4-en-3-one
 +
* molecular weight:
 +
** 398.671   
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0182_0018
+
** methylcholestenone
−
** Esi0182_0018
+
** (24R)-24-methyl-cholest-4-en-3-one
 +
** 3-dehydro-Δ4-5-campesterol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-1884]]
+
* [[RXN-711]]
−
** [[pantograph]]-[[aragem]]
+
* [[RXN-4231]]
−
== Pathways associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-882]]
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: common name=Esi_0182_0018|Esi0182_0018}}
+
* PUBCHEM:
−
{{#set: reaction associated=RXN-1884}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200612 25200612]
−
{{#set: pathway associated=PWY-882}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785]
 +
* HMDB : HMDB12196
 +
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}}
 +
{{#set: common name=campest-4-en-3-one}}
 +
{{#set: molecular weight=398.671    }}
 +
{{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-Δ4-5-campesterol}}
 +
{{#set: consumed by=RXN-711|RXN-4231}}

Revision as of 13:53, 21 March 2018

Metabolite CPD-698

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
  • common name:
    • campest-4-en-3-one
  • molecular weight:
    • 398.671
  • Synonym(s):
    • methylcholestenone
    • (24R)-24-methyl-cholest-4-en-3-one
    • 3-dehydro-Δ4-5-campesterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-20_004730&oldid=22503"