Difference between revisions of "Ec-10 002950"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-11_000770 == * left end position: ** 804364 * transcription direction: ** POSITIVE * right end position: ** 807048 * centisome position: ** 12.788...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-11_000770 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] ==
−
* left end position:
+
* smiles:
−
** 804364
+
** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
−
* right end position:
+
* common name:
−
** 807048
+
** salicyl-6-hydroxy-2-cyclohexene-on-oyl
−
* centisome position:
+
* molecular weight:
−
** 12.788675    
+
** 262.262    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0102_0025
+
** salicyl-HCH
−
** Esi0102_0025
+
** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
 +
** acylsaligenin
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[SHIKIMATE-KINASE-RXN]]
+
* [[RXN-12252]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-6163]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=804364}}
+
* CAS : 529507-98-0
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=807048}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723]
−
{{#set: centisome position=12.788675   }}
+
{{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}}
−
{{#set: common name=Esi_0102_0025|Esi0102_0025}}
+
{{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}}
−
{{#set: reaction associated=SHIKIMATE-KINASE-RXN}}
+
{{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}}
−
{{#set: pathway associated=PWY-6163}}
+
{{#set: molecular weight=262.262   }}
 +
{{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}}
 +
{{#set: consumed by=RXN-12252}}

Revision as of 13:53, 21 March 2018

Metabolite CPD-13174

  • smiles:
    • C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
  • inchi key:
    • InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
  • common name:
    • salicyl-6-hydroxy-2-cyclohexene-on-oyl
  • molecular weight:
    • 262.262
  • Synonym(s):
    • salicyl-HCH
    • 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
    • acylsaligenin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_002950&oldid=22538"