Difference between revisions of "T2-DECENOYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O * inchi ke...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10855 RXN-10855] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10855 RXN-10855] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L
+
−
* common name:
+
−
** 1-oleoyl-2-lyso-glycerone phosphate
+
−
* molecular weight:
+
−
** 432.493   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 1-oleoyl-2-lyso-dihydroxyacetone phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-15046]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 2 [[WATER]][c] '''+''' 1 [[CPD-7682]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''=>''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-468]][c]
−
* [[RXN-15044]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 2 H2O[c] '''+''' 1 1-piperideine 6-carboxylate[c] '''+''' 1 NAD(P)+[c] '''=>''' 1 NAD(P)H[c] '''+''' 1 H+[c] '''+''' 1 L-2-aminoadipate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY66-425]], L-lysine degradation II (L-pipecolate pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-425 PWY66-425]
 +
** '''3''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289257 86289257]
+
{{#set: in pathway=PWY66-425}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77492 77492]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L}}
+
−
{{#set: common name=1-oleoyl-2-lyso-glycerone phosphate}}
+
−
{{#set: molecular weight=432.493    }}
+
−
{{#set: common name=1-oleoyl-2-lyso-dihydroxyacetone phosphate}}
+
−
{{#set: consumed by=RXN-15046}}
+
−
{{#set: produced by=RXN-15044}}
+

Revision as of 13:53, 21 March 2018

Reaction RXN-10855

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY66-425, L-lysine degradation II (L-pipecolate pathway): PWY66-425
    • 3 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=T2-DECENOYL-COA&oldid=22539"