Difference between revisions of "3-HYDROXY-L-KYNURENINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYINDOLE DIHYDROXYINDOLE] == * smiles: ** C1(=CNC2(=C1C=C(O)C(O)=C2)) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Ec-26_004490 == * left end position: ** 4691585 * transcription direction: ** POSITIVE * right end position: ** 4705751 * centisome position: ** 71.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-26_004490 == |
− | * | + | * left end position: |
− | ** | + | ** 4691585 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4705751 |
− | * | + | * centisome position: |
− | ** | + | ** 71.26442 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0280_0027 |
− | ** | + | ** Esi0280_0027 |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.4.25.1-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4691585}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4705751}} | |
− | + | {{#set: centisome position=71.26442 }} | |
− | + | {{#set: common name=Esi_0280_0027|Esi0280_0027}} | |
− | + | {{#set: reaction associated=3.4.25.1-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 14:53, 21 March 2018
Gene Ec-26_004490
- left end position:
- 4691585
- transcription direction:
- POSITIVE
- right end position:
- 4705751
- centisome position:
- 71.26442
- Synonym(s):
- Esi_0280_0027
- Esi0280_0027
Reactions associated
- Reaction: 3.4.25.1-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome