Difference between revisions of "L-CYSTATHIONINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] == * smiles: ** CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
(Created page with "Category:Gene == Gene Ec-09_002030 == * left end position: ** 2424720 * transcription direction: ** POSITIVE * right end position: ** 2428110 * centisome position: ** 43.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] ==
+
== Gene Ec-09_002030 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2424720
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (2E,9Z)-hexadecenoyl-CoA
+
** 2428110
−
* molecular weight:
+
* centisome position:
−
** 997.883    
+
** 43.197052    
 
* Synonym(s):
 
* Synonym(s):
−
** 16:2-Δ2,Δ9-CoA
+
** Esi_0074_0067
−
** 2-trans,9-cis-hexadecenoyl-CoA
+
** Esi0074_0067
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17789]]
+
* Reaction: [[PMPOXI-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17788]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[PNPOXI-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7204]]
 +
* [[PWY-7282]]
 +
* [[PLPSAL-PWY]]
 +
* [[PYRIDOXSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=2424720}}
−
{{#set: inchi key=InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(2E,9Z)-hexadecenoyl-CoA}}
+
{{#set: right end position=2428110}}
−
{{#set: molecular weight=997.883   }}
+
{{#set: centisome position=43.197052   }}
−
{{#set: common name=16:2-Δ2,Δ9-CoA|2-trans,9-cis-hexadecenoyl-CoA}}
+
{{#set: common name=Esi_0074_0067|Esi0074_0067}}
−
{{#set: consumed by=RXN-17789}}
+
{{#set: reaction associated=PMPOXI-RXN|PNPOXI-RXN}}
−
{{#set: produced by=RXN-17788}}
+
{{#set: pathway associated=PWY-7204|PWY-7282|PLPSAL-PWY|PYRIDOXSYN-PWY}}

Revision as of 13:53, 21 March 2018

Gene Ec-09_002030

  • left end position:
    • 2424720
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2428110
  • centisome position:
    • 43.197052
  • Synonym(s):
    • Esi_0074_0067
    • Esi0074_0067

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=L-CYSTATHIONINE&oldid=22579"