Difference between revisions of "3-HYDROXYADIPYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] == * smiles: ** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C...")
(Created page with "Category:Gene == Gene Ec-00_001410 == * left end position: ** 1625212 * transcription direction: ** NEGATIVE * right end position: ** 1662233 * centisome position: ** 8.57...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] ==
+
== Gene Ec-00_001410 ==
−
* smiles:
+
* left end position:
−
** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)
+
** 1625212
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IDBZKGQRLBFUFQ-MTKBYBFRSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (R)-NADHX
+
** 1662233
−
* molecular weight:
+
* centisome position:
−
** 681.445    
+
** 8.577931    
 
* Synonym(s):
 
* Synonym(s):
−
** (6R)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide
+
** Esi_0013_0097
 +
** Esi0013_0097
 +
** UCH
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.4.19.12-RXN]]
−
* [[RXN-12754]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1625212}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927860 56927860]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=1662233}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64075 64075]
+
{{#set: centisome position=8.577931   }}
−
{{#set: smiles=C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)}}
+
{{#set: common name=Esi_0013_0097|Esi0013_0097|UCH}}
−
{{#set: inchi key=InChIKey=IDBZKGQRLBFUFQ-MTKBYBFRSA-L}}
+
{{#set: reaction associated=3.4.19.12-RXN}}
−
{{#set: common name=(R)-NADHX}}
+
−
{{#set: molecular weight=681.445   }}
+
−
{{#set: common name=(6R)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide}}
+
−
{{#set: produced by=RXN-12754}}
+

Revision as of 13:53, 21 March 2018

Gene Ec-00_001410

  • left end position:
    • 1625212
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1662233
  • centisome position:
    • 8.577931
  • Synonym(s):
    • Esi_0013_0097
    • Esi0013_0097
    • UCH

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-HYDROXYADIPYL-COA&oldid=22594"