Difference between revisions of "Ec-08 003590"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CC...")
(Created page with "Category:Gene == Gene Ec-12_003800 == * left end position: ** 3555323 * transcription direction: ** NEGATIVE * right end position: ** 3563451 * centisome position: ** 42.6...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] ==
+
== Gene Ec-12_003800 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** 3555323
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
+
** 3563451
−
* molecular weight:
+
* centisome position:
−
** 412.698    
+
** 42.64996    
 
* Synonym(s):
 
* Synonym(s):
−
** 5α-cholesta-8,24-dien-3β-ol
+
** Esi_0090_0069
−
** 4α,14α-dimethylzymosterol
+
** Esi0090_0069
−
** 29-norlanosterol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11881]]
+
* Reaction: [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3555323}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986191 50986191]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: right end position=3563451}}
−
{{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}}
+
{{#set: centisome position=42.64996   }}
−
{{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: common name=Esi_0090_0069|Esi0090_0069}}
−
{{#set: molecular weight=412.698   }}
+
{{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}}
−
{{#set: common name=5α-cholesta-8,24-dien-3β-ol|4α,14α-dimethylzymosterol|29-norlanosterol}}
+
−
{{#set: consumed by=RXN-11881}}
+

Revision as of 13:54, 21 March 2018

Gene Ec-12_003800

  • left end position:
    • 3555323
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3563451
  • centisome position:
    • 42.64996
  • Synonym(s):
    • Esi_0090_0069
    • Esi0090_0069

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_003590&oldid=22617"