Difference between revisions of "CPD0-2472"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-]...")
(Created page with "Category:Gene == Gene Ec-16_001000 == * left end position: ** 1145858 * transcription direction: ** NEGATIVE * right end position: ** 1159832 * centisome position: ** 21.4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17624 CPD-17624] ==
+
== Gene Ec-16_001000 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1145858
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** ω-carboxy-(9Z)-octadec-9-enoyl-CoA
+
** 1159832
−
* molecular weight:
+
* centisome position:
−
** 1056.928    
+
** 21.467445    
 
* Synonym(s):
 
* Synonym(s):
−
** 18-carboxyl oleoyl-CoA
+
** Esi_0205_0043
 +
** Esi0205_0043
 +
** ACO, C-term
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ACONITATEDEHYDR-RXN]]
−
* [[RXN-16418]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[ACONITATEHYDR-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14047]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-5750]]
 +
* [[PWY-5913]]
 +
* [[REDCITCYC]]
 +
* [[PWY-5392]]
 +
* [[P105-PWY]]
 +
* [[P23-PWY]]
 +
* [[PWY-7124]]
 +
* [[PWY-5690]]
 +
* [[GLYOXYLATE-BYPASS]]
 +
* [[FERMENTATION-PWY]]
 +
* [[PWY-6728]]
 +
* [[PWY-6549]]
 +
* [[PWY-7254]]
 +
* [[TCA]]
 +
* [[PWY66-398]]
 +
* [[PWY-6969]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1145858}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820430 91820430]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=1159832}}
−
{{#set: inchi key=InChIKey=IISWKVFHQLAOMW-BTFUZUOASA-I}}
+
{{#set: centisome position=21.467445   }}
−
{{#set: common name=ω-carboxy-(9Z)-octadec-9-enoyl-CoA}}
+
{{#set: common name=Esi_0205_0043|Esi0205_0043|ACO, C-term}}
−
{{#set: molecular weight=1056.928   }}
+
{{#set: reaction associated=ACONITATEDEHYDR-RXN|ACONITATEHYDR-RXN|RXN-14047}}
−
{{#set: common name=18-carboxyl oleoyl-CoA}}
+
{{#set: pathway associated=PWY-5750|PWY-5913|REDCITCYC|PWY-5392|P105-PWY|P23-PWY|PWY-7124|PWY-5690|GLYOXYLATE-BYPASS|FERMENTATION-PWY|PWY-6728|PWY-6549|PWY-7254|TCA|PWY66-398|PWY-6969}}
−
{{#set: produced by=RXN-16418}}
+

Revision as of 13:54, 21 March 2018

Gene Ec-16_001000

  • left end position:
    • 1145858
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1159832
  • centisome position:
    • 21.467445
  • Synonym(s):
    • Esi_0205_0043
    • Esi0205_0043
    • ACO, C-term

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD0-2472&oldid=22622"