Difference between revisions of "RXN-14224"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.99.18-RXN 4.2.99.18-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** DNA-(apurinic or ap...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CC...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.99.18-RXN 4.2.99.18-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
 
* common name:
 
* common name:
** DNA-(apurinic or apyrimidinic site) lyase
+
** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/4.2.99.18 EC-4.2.99.18]
+
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5α-cholesta-8,24-dien-3β-ol
 +
** 4α,14α-dimethylzymosterol
 +
** 29-norlanosterol
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-11881]]
** 1 [[DNA-containing-abasic-Sites]][c] '''=>''' 1 [[3-terminal-unsaturated-sugars]][c] '''+''' 1 [[5-Phosphopolynucleotides]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 a DNA containing an apurinic/apyrimidinic site[c] '''=>''' 1 a 3'-terminal unsaturated sugar[c] '''+''' 1 a 5'-phosphopolynucleotide[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Ec-01_006350]]
+
** ESILICULOSUS_GENOME
+
***GO-TERM
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* UNIPROT:
+
* PUBCHEM:
** [http://www.uniprot.org/uniprot/P0AB83 P0AB83]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986191 50986191]
** [http://www.uniprot.org/uniprot/P28352 P28352]
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
** [http://www.uniprot.org/uniprot/Q58829 Q58829]
+
{{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}}
** [http://www.uniprot.org/uniprot/Q9PHS1 Q9PHS1]
+
{{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol}}
** [http://www.uniprot.org/uniprot/Q9JVT0 Q9JVT0]
+
{{#set: molecular weight=412.698    }}
** [http://www.uniprot.org/uniprot/Q9PNL1 Q9PNL1]
+
{{#set: common name=5α-cholesta-8,24-dien-3β-ol|4α,14α-dimethylzymosterol|29-norlanosterol}}
** [http://www.uniprot.org/uniprot/P44319 P44319]
+
{{#set: consumed by=RXN-11881}}
** [http://www.uniprot.org/uniprot/Q9CGM5 Q9CGM5]
+
** [http://www.uniprot.org/uniprot/P04418 P04418]
+
** [http://www.uniprot.org/uniprot/P27695 P27695]
+
** [http://www.uniprot.org/uniprot/P23196 P23196]
+
** [http://www.uniprot.org/uniprot/P22936 P22936]
+
** [http://www.uniprot.org/uniprot/P43138 P43138]
+
** [http://www.uniprot.org/uniprot/P95945 P95945]
+
** [http://www.uniprot.org/uniprot/P50525 P50525]
+
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=DNA-(apurinic or apyrimidinic site) lyase}}
+
{{#set: ec number=EC-4.2.99.18}}
+
{{#set: gene associated=Ec-01_006350}}
+
{{#set: in pathway=}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 13:54, 21 March 2018

Metabolite CPD-12852

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
  • inchi key:
    • InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
  • common name:
    • 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
  • molecular weight:
    • 412.698
  • Synonym(s):
    • 5α-cholesta-8,24-dien-3β-ol
    • 4α,14α-dimethylzymosterol
    • 29-norlanosterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.