Difference between revisions of "Ec-25 003590"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-17_003740 == * left end position: ** 3963302 * transcription direction: ** POSITIVE * right end position: ** 3968745 * centisome position: ** 82.6...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-]...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-17_003740 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] ==
−
* left end position:
+
* smiles:
−
** 3963302
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K
−
* right end position:
+
* common name:
−
** 3968745
+
** ADP ribose 1'',2''-cyclic phosphate
−
* centisome position:
+
* molecular weight:
−
** 82.604126    
+
** 618.26    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0166_0003
+
** ADP ribose 1''-2''-cyclic phosphate
−
** Esi0166_0003
+
** ADP ribose 1'',2''-phosphate
 +
** adenosine diphosphate ribose 1'',2''-cyclic phosphate
 +
** Appr>p
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.1.26.4-RXN]]
+
* [[RXN-12055]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
* [[2.7.1.160-RXN]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3963302}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245989 25245989]
−
{{#set: right end position=3968745}}
+
* CHEBI:
−
{{#set: centisome position=82.604126   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76596 76596]
−
{{#set: common name=Esi_0166_0003|Esi0166_0003}}
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O}}
−
{{#set: reaction associated=3.1.26.4-RXN}}
+
{{#set: inchi key=InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K}}
 +
{{#set: common name=ADP ribose 1'',2''-cyclic phosphate}}
 +
{{#set: molecular weight=618.26   }}
 +
{{#set: common name=ADP ribose 1''-2''-cyclic phosphate|ADP ribose 1'',2''-phosphate|adenosine diphosphate ribose 1'',2''-cyclic phosphate|Appr>p}}
 +
{{#set: consumed by=RXN-12055}}
 +
{{#set: produced by=2.7.1.160-RXN}}

Revision as of 13:54, 21 March 2018

Metabolite CPD-9007

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O
  • inchi key:
    • InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K
  • common name:
    • ADP ribose 1,2-cyclic phosphate
  • molecular weight:
    • 618.26
  • Synonym(s):
    • ADP ribose 1-2-cyclic phosphate
    • ADP ribose 1,2-phosphate
    • adenosine diphosphate ribose 1,2-cyclic phosphate
    • Appr>p

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O" cannot be used as a page name in this wiki.


"Appr>p" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-25_003590&oldid=22633"