Difference between revisions of "Ec-25 003590"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-17_003740 == * left end position: ** 3963302 * transcription direction: ** POSITIVE * right end position: ** 3968745 * centisome position: ** 82.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == |
− | * | + | * smiles: |
− | ** | + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K |
− | * | + | * common name: |
− | ** | + | ** ADP ribose 1'',2''-cyclic phosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 618.26 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ADP ribose 1''-2''-cyclic phosphate |
− | ** | + | ** ADP ribose 1'',2''-phosphate |
+ | ** adenosine diphosphate ribose 1'',2''-cyclic phosphate | ||
+ | ** Appr>p | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-12055]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[2.7.1.160-RXN]] |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245989 25245989] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76596 76596] |
− | {{#set: common name= | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K}} |
+ | {{#set: common name=ADP ribose 1'',2''-cyclic phosphate}} | ||
+ | {{#set: molecular weight=618.26 }} | ||
+ | {{#set: common name=ADP ribose 1''-2''-cyclic phosphate|ADP ribose 1'',2''-phosphate|adenosine diphosphate ribose 1'',2''-cyclic phosphate|Appr>p}} | ||
+ | {{#set: consumed by=RXN-12055}} | ||
+ | {{#set: produced by=2.7.1.160-RXN}} |
Revision as of 13:54, 21 March 2018
Contents
Metabolite CPD-9007
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O
- inchi key:
- InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K
- common name:
- ADP ribose 1,2-cyclic phosphate
- molecular weight:
- 618.26
- Synonym(s):
- ADP ribose 1-2-cyclic phosphate
- ADP ribose 1,2-phosphate
- adenosine diphosphate ribose 1,2-cyclic phosphate
- Appr>p
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O" cannot be used as a page name in this wiki.
"Appr>p" cannot be used as a page name in this wiki.