Difference between revisions of "RXN-10705"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-] * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14789 RXN-14789] == * direction: ** LEFT-TO-RIGHT * common name: ** Acyl-CoA oxidase/dehydrogen...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14789 RXN-14789] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Acyl-CoA oxidase/dehydrogenase, central domain |
− | * | + | ** acyl-CoA oxidase, partial |
− | ** | + | ** acyl-CoA oxidase |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-15677]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[CPD-15661]][c] |
− | == | + | * With common name(s): |
+ | ** 1 4-trans-undecenoyl-CoA[c] '''+''' 1 oxygen[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 2-trans, 4-trans-undecadienoyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-22_002920]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-26_004320]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-08_006390]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-7338]], 10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7338 PWY-7338] | ||
+ | ** '''3''' reactions found over '''12''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Acyl-CoA oxidase/dehydrogenase, central domain}} | |
− | + | {{#set: common name=acyl-CoA oxidase, partial}} | |
− | + | {{#set: common name=acyl-CoA oxidase}} | |
− | + | {{#set: ec number=EC-1.3.3.6}} | |
− | + | {{#set: gene associated=Ec-22_002920|Ec-26_004320|Ec-08_006390}} | |
− | + | {{#set: in pathway=PWY-7338}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: common name= | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:54, 21 March 2018
Contents
Reaction RXN-14789
- direction:
- LEFT-TO-RIGHT
- common name:
- Acyl-CoA oxidase/dehydrogenase, central domain
- acyl-CoA oxidase, partial
- acyl-CoA oxidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-15677[c] + 1 OXYGEN-MOLECULE[c] => 1 HYDROGEN-PEROXIDE[c] + 1 CPD-15661[c]
- With common name(s):
- 1 4-trans-undecenoyl-CoA[c] + 1 oxygen[c] => 1 hydrogen peroxide[c] + 1 2-trans, 4-trans-undecadienoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-22_002920
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-26_004320
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-08_006390
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-7338, 10-trans-heptadecenoyl-CoA degradation (reductase-dependent, yeast): PWY-7338
- 3 reactions found over 12 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome