Difference between revisions of "CPD-8653"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] == * smiles: ** C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-] * inchi key: ** InChIKey=OUYCCCASQ...") |
(Created page with "Category:Gene == Gene Ec-23_001400 == * left end position: ** 1470905 * transcription direction: ** NEGATIVE * right end position: ** 1478516 * centisome position: ** 30.3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-23_001400 == |
− | * | + | * left end position: |
− | ** | + | ** 1470905 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1478516 |
− | * | + | * centisome position: |
− | ** | + | ** 30.393946 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0333_0013 |
− | ** | + | ** Esi0333_0013 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GLYOXIII-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
− | * | + | |
− | * | + | |
− | + | ||
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1470905}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1478516}} | |
− | + | {{#set: centisome position=30.393946 }} | |
− | + | {{#set: common name=Esi_0333_0013|Esi0333_0013}} | |
− | + | {{#set: reaction associated=GLYOXIII-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 13:54, 21 March 2018
Gene Ec-23_001400
- left end position:
- 1470905
- transcription direction:
- NEGATIVE
- right end position:
- 1478516
- centisome position:
- 30.393946
- Synonym(s):
- Esi_0333_0013
- Esi0333_0013
Reactions associated
- Reaction: GLYOXIII-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome