Difference between revisions of "2.1.1.19-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-24_000650 == * left end position: ** 744997 * transcription direction: ** NEGATIVE * right end position: ** 748784 * centisome position: ** 14.936...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-24_000650 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] ==
−
* left end position:
+
* smiles:
−
** 744997
+
** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
−
* right end position:
+
* common name:
−
** 748784
+
** dCTP
−
* centisome position:
+
* molecular weight:
−
** 14.936768    
+
** 463.127    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0019_0033
+
** 2'-deoxycytidine-5'-triphosphate
−
** Esi0019_0033
+
** deoxycytidine-triphosphate
−
** UROD3
+
** deoxy-CTP
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-10642]]
+
* [[RXN-14216]]
−
** esiliculosus_genome
+
* [[RXN-14198]]
−
***ec-number
+
== Reaction(s) known to produce the compound ==
−
* [[UROGENDECARBOX-RXN]]
+
* [[RXN0-723]]
−
** esiliculosus_genome
+
* [[DCDPKIN-RXN]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[HEMESYN2-PWY]]
+
−
* [[PWY0-1415]]
+
−
* [[HEME-BIOSYNTHESIS-II]]
+
−
* [[PWY-7766]]
+
−
* [[CHLOROPHYLL-SYN]]
+
−
* [[PWY-7159]]
+
−
* [[PWY-5531]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=744997}}
+
* CAS : 2056-98-6
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=748784}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665]
−
{{#set: centisome position=14.936768   }}
+
* HMDB : HMDB00998
−
{{#set: common name=Esi_0019_0033|Esi0019_0033|UROD3}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=RXN-10642|UROGENDECARBOX-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458]
−
{{#set: pathway associated=HEMESYN2-PWY|PWY0-1415|HEME-BIOSYNTHESIS-II|PWY-7766|CHLOROPHYLL-SYN|PWY-7159|PWY-5531}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481]
 +
* BIGG : 35027
 +
{{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}}
 +
{{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}}
 +
{{#set: common name=dCTP}}
 +
{{#set: molecular weight=463.127   }}
 +
{{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}}
 +
{{#set: consumed by=RXN-14216|RXN-14198}}
 +
{{#set: produced by=RXN0-723|DCDPKIN-RXN}}

Revision as of 13:54, 21 March 2018

Metabolite DCTP

  • smiles:
    • C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
  • inchi key:
    • InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
  • common name:
    • dCTP
  • molecular weight:
    • 463.127
  • Synonym(s):
    • 2'-deoxycytidine-5'-triphosphate
    • deoxycytidine-triphosphate
    • deoxy-CTP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 2056-98-6
  • PUBCHEM:
  • HMDB : HMDB00998
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : 35027
"C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=2.1.1.19-RXN&oldid=22722"