Difference between revisions of "Ec-04 001920"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * inchi key: **...")
(Created page with "Category:Gene == Gene Ec-12_002050 == * left end position: ** 1908870 * transcription direction: ** POSITIVE * right end position: ** 1913117 * centisome position: ** 22.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] ==
+
== Gene Ec-12_002050 ==
−
* smiles:
+
* left end position:
−
** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))
+
** 1908870
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4α-hydroxy-tetrahydrobiopterin
+
** 1913117
−
* molecular weight:
+
* centisome position:
−
** 257.249    
+
** 22.89897    
 
* Synonym(s):
 
* Synonym(s):
−
** 4α-hydroxy-5,6,7,8-tetrahydrobiopterin
+
** Esi_0144_0037
−
** 4α-hydroxy-tetrahydropterin
+
** Esi0144_0037
−
** 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7908]]
+
* Reaction: [[ARYLSULFAT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN66-569]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1908870}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657593 90657593]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1913117}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15374 15374]
+
{{#set: centisome position=22.89897   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0144_0037|Esi0144_0037}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15522 C15522]
+
{{#set: reaction associated=ARYLSULFAT-RXN}}
−
* HMDB : HMDB02281
+
−
{{#set: smiles=CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))}}
+
−
{{#set: inchi key=InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N}}
+
−
{{#set: common name=4α-hydroxy-tetrahydrobiopterin}}
+
−
{{#set: molecular weight=257.249   }}
+
−
{{#set: common name=4α-hydroxy-5,6,7,8-tetrahydrobiopterin|4α-hydroxy-tetrahydropterin|6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin}}
+
−
{{#set: consumed by=RXN-7908}}
+
−
{{#set: produced by=RXN66-569}}
+

Revision as of 13:54, 21 March 2018

Gene Ec-12_002050

  • left end position:
    • 1908870
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1913117
  • centisome position:
    • 22.89897
  • Synonym(s):
    • Esi_0144_0037
    • Esi0144_0037

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-04_001920&oldid=22732"