Difference between revisions of "25S-rRNA-adenine-2142"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * inchi key: ** InChIKey=HII...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.4.14-RXN 1.8.4.14-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Methionine-R-sulfoxid...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.4.14-RXN 1.8.4.14-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Methionine-R-sulfoxide reductase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.8.4.14 EC-1.8.4.14] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CPD-8990]][c] '''+''' 1 [[Red-Thioredoxin]][c] '''=>''' 1 [[Ox-Thioredoxin]][c] '''+''' 1 [[MET]][c] '''+''' 1 [[WATER]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 L-methionine-(R)-S-oxide[c] '''+''' 1 a reduced thioredoxin[c] '''=>''' 1 an oxidized thioredoxin[c] '''+''' 1 L-methionine[c] '''+''' 1 H2O[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-05_006220]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21260 21260] | |
− | + | * LIGAND-RXN: | |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07608 R07608] |
− | * | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=Methionine-R-sulfoxide reductase}} | |
− | ** [http:// | + | {{#set: ec number=EC-1.8.4.14}} |
− | + | {{#set: gene associated=Ec-05_006220}} | |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:55, 21 March 2018
Contents
Reaction 1.8.4.14-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Methionine-R-sulfoxide reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-8990[c] + 1 Red-Thioredoxin[c] => 1 Ox-Thioredoxin[c] + 1 MET[c] + 1 WATER[c]
- With common name(s):
- 1 L-methionine-(R)-S-oxide[c] + 1 a reduced thioredoxin[c] => 1 an oxidized thioredoxin[c] + 1 L-methionine[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-05_006220
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links