Difference between revisions of "CPDQT-4"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHO-ENOL-PYRUVATE PHOSPHO-ENOL-PYRUVATE] == * smiles: ** C=C(OP([O-])([O-])=O)C([O-])=O * i...") |
(Created page with "Category:Gene == Gene Ec-06_002880 == * left end position: ** 2213636 * transcription direction: ** NEGATIVE * right end position: ** 2223495 * centisome position: ** 25.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_002880 == |
− | * | + | * left end position: |
− | ** | + | ** 2213636 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2223495 |
− | * | + | * centisome position: |
− | ** | + | ** 25.276285 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0165_0003 |
− | ** | + | ** Esi0165_0003 |
− | ** | + | ** PAO-like |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-13398]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | * | + | * Reaction: [[RXN-7676]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | + | * Reaction: [[RXN-7677]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * | + | *** Assignment: go-term |
− | * [[RXN- | + | == Pathways associated == |
− | * [[ | + | * [[PWY-5068]] |
− | * | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=2213636}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2223495}} | |
− | + | {{#set: centisome position=25.276285 }} | |
− | + | {{#set: common name=Esi_0165_0003|Esi0165_0003|PAO-like}} | |
− | + | {{#set: reaction associated=RXN-13398|RXN-7676|RXN-7677}} | |
− | + | {{#set: pathway associated=PWY-5068}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 13:55, 21 March 2018
Gene Ec-06_002880
- left end position:
- 2213636
- transcription direction:
- NEGATIVE
- right end position:
- 2223495
- centisome position:
- 25.276285
- Synonym(s):
- Esi_0165_0003
- Esi0165_0003
- PAO-like
Reactions associated
- Reaction: RXN-13398
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-7676
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-7677
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome