Difference between revisions of "CPD-17046"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-15_000120 == * left end position: ** 203531 * transcription direction: ** NEGATIVE * right end position: ** 213966 * centisome position: ** 3.7703...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L |
| − | * | + | * common name: |
| − | ** | + | ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 728.942 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-16118]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819824 91819824] | |
| − | {{#set: | + | {{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L}} |
| − | {{#set: common name= | + | {{#set: common name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate}} |
| − | {{#set: | + | {{#set: molecular weight=728.942 }} |
| − | {{#set: | + | {{#set: produced by=RXN-16118}} |
Revision as of 13:55, 21 March 2018
Contents
Metabolite CPD-17373
- smiles:
- C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O
- inchi key:
- InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L
- common name:
- 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
- molecular weight:
- 728.942
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.
"1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate" cannot be used as a page name in this wiki.
