Difference between revisions of "Ec-03 002180"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17472 RXN-17472] == * direction: ** REVERSIBLE * common name: ** biotin synthase * Synonym(s):...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == * smiles: ** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17472 RXN-17472] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)
 +
* inchi key:
 +
** InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N
 
* common name:
 
* common name:
−
** biotin synthase
+
** pelargonidin-3,5-di-O-β-D-glucoside
 +
* molecular weight:
 +
** 594.525   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 2 [[Reduced-2Fe-2S-Ferredoxins]][c] '''+''' 1 [[DETHIOBIOTIN]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Sulfurated-Sulfur-Acceptors]][c] '''<=>''' 1 [[Unsulfurated-Sulfur-Acceptors]][c] '''+''' 2 [[Oxidized-2Fe-2S-Ferredoxins]][c] '''+''' 1 [[CH33ADO]][c] '''+''' 1 [[CPD-5662]][c] '''+''' 1 [[MET]][c]
+
* [[RXN-7828]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 a reduced [2Fe-2S] ferredoxin[c] '''+''' 1 dethiobiotin[c] '''+''' 1 S-adenosyl-L-methionine[c] '''+''' 1 H+[c] '''+''' 1 a sulfurated [sulfur carrier][c] '''<=>''' 1 an unsulfurated [sulfur carrier][c] '''+''' 2 an oxidized [2Fe-2S] ferredoxin[c] '''+''' 1 5'-deoxyadenosine[c] '''+''' 1 9-mercaptodethiobiotin[c] '''+''' 1 L-methionine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-24_000980]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=biotin synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167643 167643]
−
{{#set: gene associated=Ec-24_000980}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57503 57503]
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08725 C08725]
−
{{#set: reconstruction tool=pathwaytools}}
+
* HMDB : HMDB33681
 +
{{#set: smiles=C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)}}
 +
{{#set: inchi key=InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N}}
 +
{{#set: common name=pelargonidin-3,5-di-O-&beta;-D-glucoside}}
 +
{{#set: molecular weight=594.525    }}
 +
{{#set: produced by=RXN-7828}}

Revision as of 13:55, 21 March 2018

Metabolite CPD-7137

  • smiles:
    • C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)
  • inchi key:
    • InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N
  • common name:
    • pelargonidin-3,5-di-O-β-D-glucoside
  • molecular weight:
    • 594.525
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_002180&oldid=22855"