Difference between revisions of "Protein-L-methionine-S-S-oxides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16082 RXN-16082] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11521 CPD-11521] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16082 RXN-16082] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11521 CPD-11521] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1]
+
** InChIKey=VWFUYQVGVAEVNH-CNALLRBTSA-J
 +
* common name:
 +
** OPC6-CoA
 +
* molecular weight:
 +
** 1011.867   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-10706]]
** 1 [[MALONYL-COA]][c] '''+''' 1 [[CPD-14426]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-17332]][c] '''+''' 1 [[CO-A]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 malonyl-CoA[c] '''+''' 1 docosapentaenoyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 3-oxo-tetracosapentaenoyl-CoA[c] '''+''' 1 coenzyme A[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-7606]], docosahexaenoate biosynthesis III (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7606 PWY-7606]
+
** '''14''' reactions found over '''14''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-2.3.1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237133 44237133]
{{#set: in pathway=PWY-7606}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=VWFUYQVGVAEVNH-CNALLRBTSA-J}}
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: common name=OPC6-CoA}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=1011.867    }}
 +
{{#set: consumed by=RXN-10706}}

Revision as of 13:56, 21 March 2018

Metabolite CPD-11521

  • smiles:
    • CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
  • inchi key:
    • InChIKey=VWFUYQVGVAEVNH-CNALLRBTSA-J
  • common name:
    • OPC6-CoA
  • molecular weight:
    • 1011.867
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.