Difference between revisions of "ISOLEUCINE--TRNA-LIGASE-RXN"

Revision as of 13:56, 21 March 2018

"CC1(OC(O[R])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphoglucomutase Phosphoglucomutase] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AN-ALPHA-L-FUCOSIDE AN-ALPHA-L-FUCOSIDE] ==
+* smiles:
+** CC1(OC(O[R])C(O)C(O)C(O)1)
 * common name:
-** a phosphoglucomutase
+** &alpha;-L-fucoside
 * Synonym(s):
 == Reaction(s) known to consume the compound ==
+* [[ALPHA-L-FUCOSIDASE-RXN]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
-* [[RXN-16997]]
-* [[RXN-16998]]
 == External links  ==
-{{#set: common name=a phosphoglucomutase}}
+* LIGAND-CPD:
-{{#set: reversible reaction associated=RXN-16997|RXN-16998}}
+** [http://www.genome.jp/dbget-bin/www_bget?C02475 C02475]
+* CHEBI:
+** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28349 28349]
+{{#set: smiles=CC1(OC(O[R])C(O)C(O)C(O)1)}}
+{{#set: common name=&alpha;-L-fucoside}}
+{{#set: consumed by=ALPHA-L-FUCOSIDASE-RXN}}