Difference between revisions of "Ec-03 004860"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] == * smiles: ** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2E-11Z-icosa-2-11-dienoyl-ACPs 2E-11Z-icosa-2-11-dienoyl-ACPs] == * common name: ** an (2E,11Z)...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2E-11Z-icosa-2-11-dienoyl-ACPs 2E-11Z-icosa-2-11-dienoyl-ACPs] ==
* smiles:
+
** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J
+
 
* common name:
 
* common name:
** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA
+
** an (2E,11Z)-icosa-2,11-dienoyl-[acp]
* molecular weight:
+
** 967.814   
+
 
* Synonym(s):
 
* Synonym(s):
** 2E, 5Z, 7E-tetradecatrienoyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16632]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14796]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an (2E,11Z)-icosa-2,11-dienoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657959 90657959]
+
{{#set: consumed by=RXN-16632}}
{{#set: smiles=CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J}}
+
{{#set: common name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA}}
+
{{#set: molecular weight=967.814    }}
+
{{#set: common name=2E, 5Z, 7E-tetradecatrienoyl-CoA}}
+
{{#set: produced by=RXN-14796}}
+

Revision as of 13:56, 21 March 2018

Metabolite 2E-11Z-icosa-2-11-dienoyl-ACPs

  • common name:
    • an (2E,11Z)-icosa-2,11-dienoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an (2E,11Z)-icosa-2,11-dienoyl-[acp" cannot be used as a page name in this wiki.