Difference between revisions of "RXN66-546"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] == * smiles: ** C(CCC[N+]CCC[N+])[N+]CCC[N+] * inchi key: ** InChIKey=PFNFFQ...") |
(Created page with "Category:Gene == Gene Ec-24_003550 == * left end position: ** 3854575 * transcription direction: ** NEGATIVE * right end position: ** 3867197 * centisome position: ** 77.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-24_003550 == |
− | * | + | * left end position: |
− | ** | + | ** 3854575 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3867197 |
− | * | + | * centisome position: |
− | ** | + | ** 77.28204 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0034_0066 |
− | ** | + | ** Esi0034_0066 |
− | ** | + | ** TOP6B |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3854575}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3867197}} | |
− | + | {{#set: centisome position=77.28204 }} | |
− | + | {{#set: common name=Esi_0034_0066|Esi0034_0066|TOP6B}} | |
− | + | {{#set: reaction associated=HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:56, 21 March 2018
Gene Ec-24_003550
- left end position:
- 3854575
- transcription direction:
- NEGATIVE
- right end position:
- 3867197
- centisome position:
- 77.28204
- Synonym(s):
- Esi_0034_0066
- Esi0034_0066
- TOP6B
Reactions associated
- Reaction: HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome