Difference between revisions of "Aldehydes"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=diacyl-3-O-glucl-1-6-gluc-sn-glycerol diacyl-3-O-glucl-1-6-gluc-sn-glycerol] == * common name:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE NN-DIMETHYLANILINE] == * smiles: ** CN(C1(C=CC=CC=1))C * inchi key: ** InChI...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE NN-DIMETHYLANILINE] == |
| + | * smiles: | ||
| + | ** CN(C1(C=CC=CC=1))C | ||
| + | * inchi key: | ||
| + | ** InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** N,N-dimethylaniline |
| + | * molecular weight: | ||
| + | ** 121.182 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[1.14.13.8-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: | + | * NCI: |
| − | {{#set: | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=7195 7195] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=949 949] | ||
| + | * HMDB : HMDB01020 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02846 C02846] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.924.html 924] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16269 16269] | ||
| + | {{#set: smiles=CN(C1(C=CC=CC=1))C}} | ||
| + | {{#set: inchi key=InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=N,N-dimethylaniline}} | ||
| + | {{#set: molecular weight=121.182 }} | ||
| + | {{#set: consumed by=1.14.13.8-RXN}} | ||
Revision as of 13:56, 21 March 2018
Contents
Metabolite NN-DIMETHYLANILINE
- smiles:
- CN(C1(C=CC=CC=1))C
- inchi key:
- InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N
- common name:
- N,N-dimethylaniline
- molecular weight:
- 121.182
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
