Difference between revisions of "Cis-delta-3-decenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRECURSOR-Z PRECURSOR-Z] == * smiles: ** C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9653 RXN-9653] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-[acyl-carrier-prote...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRECURSOR-Z PRECURSOR-Z] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9653 RXN-9653] ==
−
* smiles:
+
* direction:
−
** C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PWFXLXMPGSLEOZ-QQVWSJFJSA-M
+
 
* common name:
 
* common name:
−
** cyclic pyranopterin phosphate
+
** 3-oxoacyl-[acyl-carrier-protein] synthase
−
* molecular weight:
+
** Beta-ketoacyl synthase, N-terminal
−
** 344.2  
+
** Thiolase-like, subgroup
 +
** beta-ketoacyl synthase, partial
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
−
** precursor Z
 
−
** cPMP
 
−
** precursor-Z
 
−
** 8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide
 
−
** 8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide
 
−
** cyclic pyranopterin monophosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8342]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[MALONYL-COA]][c] '''+''' 1 [[Dodecanoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[3-oxo-myristoyl-ACPs]][c]
−
* [[RXN-8340]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 malonyl-CoA[c] '''+''' 1 a dodecanoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 coenzyme A[c] '''+''' 1 CO2[c] '''+''' 1 a 3-oxo-myristoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_003480]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-27_002090]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-12_000640]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-12_000650]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 +
** '''20''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659039 90659039]
+
{{#set: common name=3-oxoacyl-[acyl-carrier-protein] synthase}}
−
* CHEBI:
+
{{#set: common name=Beta-ketoacyl synthase, N-terminal}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59648 59648]
+
{{#set: common name=Thiolase-like, subgroup}}
−
{{#set: smiles=C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4))))}}
+
{{#set: common name=beta-ketoacyl synthase, partial}}
−
{{#set: inchi key=InChIKey=PWFXLXMPGSLEOZ-QQVWSJFJSA-M}}
+
{{#set: ec number=EC-2.3.1.86}}
−
{{#set: common name=cyclic pyranopterin phosphate}}
+
{{#set: ec number=EC-2.3.1.85}}
−
{{#set: molecular weight=344.2   }}
+
{{#set: ec number=EC-2.3.1.41}}
−
{{#set: common name=precursor Z|cPMP|precursor-Z|8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide|8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide|cyclic pyranopterin monophosphate}}
+
{{#set: gene associated=Ec-27_003480|Ec-27_002090|Ec-12_000640|Ec-12_000650}}
−
{{#set: consumed by=RXN-8342}}
+
{{#set: in pathway=PWY-5994}}
−
{{#set: produced by=RXN-8340}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 13:56, 21 March 2018

Reaction RXN-9653

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxoacyl-[acyl-carrier-protein] synthase
    • Beta-ketoacyl synthase, N-terminal
    • Thiolase-like, subgroup
    • beta-ketoacyl synthase, partial
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 20 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"3-oxoacyl-[acyl-carrier-protein] synthase" cannot be used as a page name in this wiki.






Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Cis-delta-3-decenoyl-ACPs&oldid=22997"