Difference between revisions of "RXN66-477"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14228 RXN-14228] == * direction: ** REVERSIBLE * common name: ** nucleoside diphosphate kinase...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14228 RXN-14228] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=FJWJALRUNNZIBB-DDQUOPDJSA-J
+
 
* common name:
 
* common name:
−
** dihomo γ-linolenoyl-CoA
+
** nucleoside diphosphate kinase
−
* molecular weight:
+
** Nucleoside diphosphate kinase
−
** 1051.975   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.7.4.6 EC-2.7.4.6]
 
* Synonym(s):
 
* Synonym(s):
−
** (8Z,11Z,14Z)-icosatrienoyl-CoA
 
−
** (8Z,11Z,14Z)-icosa-8,11,14-trienoyl-CoA
 
−
** (8Z,11Z,14Z)-eicosa-8,11,14-trienoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16044]]
+
* With identifiers:
−
* [[RXN-13435]]
+
** 1 [[CPD0-2231]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[DITP]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-17105]]
+
** 1 dIDP[c] '''+''' 1 ATP[c] '''<=>''' 1 ADP[c] '''+''' 1 dITP[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-11_004330]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-03_001380]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-26_003930]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-04_001140]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-07_000140]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-11_005170]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-22_003280]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581179 71581179]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30942 30942]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74264 74264]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03530 R03530]
−
{{#set: smiles=CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=REVERSIBLE}}
−
{{#set: inchi key=InChIKey=FJWJALRUNNZIBB-DDQUOPDJSA-J}}
+
{{#set: common name=nucleoside diphosphate kinase}}
−
{{#set: common name=dihomo &gamma;-linolenoyl-CoA}}
+
{{#set: common name=Nucleoside diphosphate kinase}}
−
{{#set: molecular weight=1051.975    }}
+
{{#set: ec number=EC-2.7.4.6}}
−
{{#set: common name=(8Z,11Z,14Z)-icosatrienoyl-CoA|(8Z,11Z,14Z)-icosa-8,11,14-trienoyl-CoA|(8Z,11Z,14Z)-eicosa-8,11,14-trienoyl-CoA}}
+
{{#set: gene associated=Ec-11_004330|Ec-03_001380|Ec-26_003930|Ec-04_001140|Ec-07_000140|Ec-11_005170|Ec-22_003280}}
−
{{#set: consumed by=RXN-16044|RXN-13435}}
+
{{#set: in pathway=}}
−
{{#set: produced by=RXN-17105}}
+
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 13:57, 21 March 2018

Reaction RXN-14228

  • direction:
    • REVERSIBLE
  • common name:
    • nucleoside diphosphate kinase
    • Nucleoside diphosphate kinase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 dIDP[c] + 1 ATP[c] <=> 1 ADP[c] + 1 dITP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN66-477&oldid=23046"