Difference between revisions of "CPD-707"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-] * common name: ** di-homo-&g...") |
(Created page with "Category:Gene == Gene Ec-13_002970 == * left end position: ** 4690786 * transcription direction: ** POSITIVE * right end position: ** 4697483 * centisome position: ** 67.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-13_002970 == |
− | * | + | * left end position: |
− | ** | + | ** 4690786 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4697483 |
− | * | + | * centisome position: |
− | ** | + | ** 67.62695 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0096_0018 |
− | ** | + | ** Esi0096_0018 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-15556]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4690786}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4697483}} | |
− | + | {{#set: centisome position=67.62695 }} | |
− | + | {{#set: common name=Esi_0096_0018|Esi0096_0018}} | |
− | + | {{#set: reaction associated=RXN-15556}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:57, 21 March 2018
Gene Ec-13_002970
- left end position:
- 4690786
- transcription direction:
- POSITIVE
- right end position:
- 4697483
- centisome position:
- 67.62695
- Synonym(s):
- Esi_0096_0018
- Esi0096_0018
Reactions associated
- Reaction: RXN-15556
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome