Difference between revisions of "Ec-16 001550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-03_000730 == * Synonym(s): ** Esi_0027_0052 ** Esi0027_0052 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-03_000730 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] ==
 +
* smiles:
 +
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
 +
* inchi key:
 +
** InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
 +
* common name:
 +
** dihydrogeranylgeranyl chlorophyll a
 +
* molecular weight:
 +
** 888.463   
 
* Synonym(s):
 
* Synonym(s):
** Esi_0027_0052
+
** dihydrogeranylgeranyl-chl a
** Esi0027_0052
+
** dihydroGG-chl a
 +
** dihydroGG-chlorophyll a
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-8443]]
+
* [[RXN-7665]]
** [[pantograph]]-[[aragem]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
* [[RXN-7664]]
* [[PWY-5381]]
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=Esi_0027_0052|Esi0027_0052}}
+
* PUBCHEM:
{{#set: reaction associated=RXN-8443}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926294 46926294]
{{#set: pathway associated=PWY-5381}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
 +
{{#set: inchi key=InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M}}
 +
{{#set: common name=dihydrogeranylgeranyl chlorophyll a}}
 +
{{#set: molecular weight=888.463    }}
 +
{{#set: common name=dihydrogeranylgeranyl-chl a|dihydroGG-chl a|dihydroGG-chlorophyll a}}
 +
{{#set: consumed by=RXN-7665}}
 +
{{#set: produced by=RXN-7664}}

Revision as of 13:57, 21 March 2018

Metabolite CPD-7004

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • inchi key:
    • InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
  • common name:
    • dihydrogeranylgeranyl chlorophyll a
  • molecular weight:
    • 888.463
  • Synonym(s):
    • dihydrogeranylgeranyl-chl a
    • dihydroGG-chl a
    • dihydroGG-chlorophyll a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.