Difference between revisions of "CPD-19172"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-GLU ACETYL-GLU] == * smiles: ** CC(=O)NC(C([O-])=O)CCC(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE-REDUCT-RXN 2-DEHYDROPANTOATE-REDUCT-RXN] == * direction: ** LEFT-TO-RIGHT * commo...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE-REDUCT-RXN 2-DEHYDROPANTOATE-REDUCT-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** 2-dehydropantoate 2-reductase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.169 EC-1.1.1.169] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[NADPH]][c] '''+''' 1 [[2-DEHYDROPANTOATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[L-PANTOATE]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 NADPH[c] '''+''' 1 2-dehydropantoate[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 (R)-pantoate[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-14_006010]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PANTO-PWY]], phosphopantothenate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PANTO-PWY PANTO-PWY] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-6654]], phosphopantothenate biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6654 PWY-6654] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16233 16233] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02472 R02472] |
− | + | * UNIPROT: | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/Q9CFY8 Q9CFY8] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/Q9V0N0 Q9V0N0] |
− | * | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www. | + | {{#set: common name=2-dehydropantoate 2-reductase}} |
− | + | {{#set: ec number=EC-1.1.1.169}} | |
− | ** [http://www. | + | {{#set: gene associated=Ec-14_006010}} |
− | + | {{#set: in pathway=PANTO-PWY|PWY-6654}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:57, 21 March 2018
Contents
Reaction 2-DEHYDROPANTOATE-REDUCT-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 2-dehydropantoate 2-reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADPH[c] + 1 2-DEHYDROPANTOATE[c] + 1 PROTON[c] => 1 NADP[c] + 1 L-PANTOATE[c]
- With common name(s):
- 1 NADPH[c] + 1 2-dehydropantoate[c] + 1 H+[c] => 1 NADP+[c] + 1 (R)-pantoate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-14_006010
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PANTO-PWY, phosphopantothenate biosynthesis I: PANTO-PWY
- 4 reactions found over 4 reactions in the full pathway
- PWY-6654, phosphopantothenate biosynthesis III: PWY-6654
- 2 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links