Difference between revisions of "XANTHINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3))) * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5-DEHYDROGENASE-RXN SHIKIMATE-5-DEHYDROGENASE-RXN] == * direction: ** LEFT-TO-RIGHT * com...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5-DEHYDROGENASE-RXN SHIKIMATE-5-DEHYDROGENASE-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** shikimate 3-dehydrogenase (NADP+) |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.25 EC-1.1.1.25] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[3-DEHYDRO-SHIKIMATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[SHIKIMATE]][c] '''+''' 1 [[NADP]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 3-dehydroshikimate[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 shikimate[c] '''+''' 1 NADP+[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-02_006010]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6163]], chorismate biosynthesis from 3-dehydroquinate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6163 PWY-6163] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17737 17737] |
− | * | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02413 R02413] |
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P07547 P07547] |
− | * | + | ** [http://www.uniprot.org/uniprot/P08566 P08566] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q58484 Q58484] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PIA0 Q9PIA0] |
− | * | + | ** [http://www.uniprot.org/uniprot/P0A6D5 P0A6D5] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9CES7 Q9CES7] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q44606 Q44606] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q44608 Q44608] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q44609 Q44609] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q44610 Q44610] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q44611 Q44611] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q44612 Q44612] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P15770 P15770] |
+ | ** [http://www.uniprot.org/uniprot/Q42947 Q42947] | ||
+ | ** [http://www.uniprot.org/uniprot/O65917 O65917] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=shikimate 3-dehydrogenase (NADP+)}} | ||
+ | {{#set: ec number=EC-1.1.1.25}} | ||
+ | {{#set: gene associated=Ec-02_006010}} | ||
+ | {{#set: in pathway=PWY-6163}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 13:57, 21 March 2018
Contents
Reaction SHIKIMATE-5-DEHYDROGENASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- shikimate 3-dehydrogenase (NADP+)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 3-DEHYDRO-SHIKIMATE[c] + 1 PROTON[c] + 1 NADPH[c] => 1 SHIKIMATE[c] + 1 NADP[c]
- With common name(s):
- 1 3-dehydroshikimate[c] + 1 H+[c] + 1 NADPH[c] => 1 shikimate[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-02_006010
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6163, chorismate biosynthesis from 3-dehydroquinate: PWY-6163
- 6 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: