Difference between revisions of "Ec-08 002400"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-13_004610 == * Synonym(s): ** Esi_0106_0084 ** Esi0106_0084 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3))) * in...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == |
+ | * smiles: | ||
+ | ** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-M | ||
+ | * common name: | ||
+ | ** quercetin | ||
+ | * molecular weight: | ||
+ | ** 301.232 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3,5,7,3',4'-pentahydroxyflavone |
− | ** | + | ** 3,5,7,3',4'-pentahydroflavone |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN1F-462]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-527]] |
− | + | == Reaction(s) of unknown directionality == | |
== External links == | == External links == | ||
− | {{#set: common name= | + | * NCI: |
− | {{#set: | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=9219 9219] |
− | {{#set: | + | * CAS : 117-39-5 |
+ | * Wikipedia : Quercetin | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906036 46906036] | ||
+ | * HMDB : HMDB05794 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00389 C00389] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57694 57694] | ||
+ | {{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))}} | ||
+ | {{#set: inchi key=InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=quercetin}} | ||
+ | {{#set: molecular weight=301.232 }} | ||
+ | {{#set: common name=3,5,7,3',4'-pentahydroxyflavone|3,5,7,3',4'-pentahydroflavone}} | ||
+ | {{#set: consumed by=RXN1F-462}} | ||
+ | {{#set: produced by=RXN-527}} |
Revision as of 13:57, 21 March 2018
Contents
Metabolite CPD-520
- smiles:
- C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))
- inchi key:
- InChIKey=REFJWTPEDVJJIY-UHFFFAOYSA-M
- common name:
- quercetin
- molecular weight:
- 301.232
- Synonym(s):
- 3,5,7,3',4'-pentahydroxyflavone
- 3,5,7,3',4'-pentahydroflavone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- NCI:
- CAS : 117-39-5
- Wikipedia : Quercetin
- PUBCHEM:
- HMDB : HMDB05794
- LIGAND-CPD:
- CHEBI:
"C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3)))" cannot be used as a page name in this wiki.