Difference between revisions of "NEUROSPORENE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-497 CPD-497] == * smiles: ** C1(=C(C(=O)NC(=O)N1)C2(OC(CO)C(O)C(O)2)) * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Ec-01_008900 == * left end position: ** 7525434 * transcription direction: ** NEGATIVE * right end position: ** 7540443 * centisome position: ** 72.9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_008900 == |
− | * | + | * left end position: |
− | ** | + | ** 7525434 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 7540443 |
− | * | + | * centisome position: |
− | ** | + | ** 72.929115 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0203_0013 | ||
+ | ** Esi0203_0013 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7525434}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=7540443}} | |
− | + | {{#set: centisome position=72.929115 }} | |
− | + | {{#set: common name=Esi_0203_0013|Esi0203_0013}} | |
− | + | {{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:58, 21 March 2018
Gene Ec-01_008900
- left end position:
- 7525434
- transcription direction:
- NEGATIVE
- right end position:
- 7540443
- centisome position:
- 72.929115
- Synonym(s):
- Esi_0203_0013
- Esi0203_0013
Reactions associated
- Reaction: UBIQUITIN--PROTEIN-LIGASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome