Difference between revisions of "Saturated-2-Lysophosphatidates"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octapeptides Octapeptides] == * common name: ** an octapeptide * Synonym(s): == Reaction(s) kn...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == * smiles: ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O * inchi key: ** InChIKey=...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == |
| + | * smiles: | ||
| + | ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** tributyrin |
| + | * molecular weight: | ||
| + | ** 302.367 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** butyryl triglyceride | ||
| + | ** butanoic acid, 1,2,3-propanetriyl ester | ||
| + | ** 1,2,3-tributyrylglycerol | ||
| + | ** tributin | ||
| + | ** tributyrinine | ||
| + | ** glycerol tributyrate | ||
| + | ** glyceryl tributyrate | ||
| + | ** butyrin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12086]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C13870 C13870] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.13849665.html 13849665] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35020 35020] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6050 6050] | ||
| + | * HMDB : HMDB31094 | ||
| + | {{#set: smiles=CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O}} | ||
| + | {{#set: inchi key=InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=tributyrin}} | ||
| + | {{#set: molecular weight=302.367 }} | ||
| + | {{#set: common name=butyryl triglyceride|butanoic acid, 1,2,3-propanetriyl ester|1,2,3-tributyrylglycerol|tributin|tributyrinine|glycerol tributyrate|glyceryl tributyrate|butyrin}} | ||
| + | {{#set: consumed by=RXN-12086}} | ||
Revision as of 14:58, 21 March 2018
Contents
Metabolite CPD-13014
- smiles:
- CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O
- inchi key:
- InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N
- common name:
- tributyrin
- molecular weight:
- 302.367
- Synonym(s):
- butyryl triglyceride
- butanoic acid, 1,2,3-propanetriyl ester
- 1,2,3-tributyrylglycerol
- tributin
- tributyrinine
- glycerol tributyrate
- glyceryl tributyrate
- butyrin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
