Difference between revisions of "PWY490-3"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * smiles: ** C(O)C1(OC(C(C(C1O)=O)O)O) * inchi key: ** InChIKey=APIQNBNBI...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY490-3 PWY490-3] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY490-3 PWY490-3] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** nitrate reduction VI (assimilatory) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** nitrate assimilation |
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''3''' reactions found over '''4''' reactions in the full pathway | |
− | * [[ | + | * [[FERREDOXIN--NITRITE-REDUCTASE-RXN]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Ec-01_002720]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[GLUTAMINESYN-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-15_004120]] | ||
+ | *** [[Ec-15_004110]] | ||
+ | *** [[Ec-09_000640]] | ||
+ | *** [[Ec-21_003610]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[GLUTDEHYD-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-06_008240]] | ||
+ | *** [[Ec-12_008040]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=1.7.7.2-RXN 1.7.7.2-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1117}} | |
− | + | {{#set: common name=nitrate reduction VI (assimilatory)}} | |
− | + | {{#set: common name=nitrate assimilation}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=75.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:00, 21 March 2018
Pathway PWY490-3
- taxonomic range:
- common name:
- nitrate reduction VI (assimilatory)
- Synonym(s):
- nitrate assimilation
Reaction(s) found
3 reactions found over 4 reactions in the full pathway
- FERREDOXIN--NITRITE-REDUCTASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- GLUTAMINESYN-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- GLUTDEHYD-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated: