Difference between revisions of "CPD-85"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5101 PWY-5101] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183924 TAX-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] == * smiles: ** CSCCC(C([O-])=CO)=O * inchi key: ** InChIKey=CILXJJLQPTUUSS-XQRV...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CSCCC(C([O-])=CO)=O |
| − | + | * inchi key: | |
| − | + | ** InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M | |
| − | * | + | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one |
| + | * molecular weight: | ||
| + | ** 161.195 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 1,2-dihydroxy-3-keto-5-methylthiopentene anion | ||
| + | ** 1,2-dihydroxy-3-keto-5-methylthiopentane | ||
| + | ** 1,2-dihydroxy-3-keto-5-methylthiopentene | ||
| + | ** acireductone | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[R147-RXN]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229177 44229177] | |
| − | + | * CHEBI: | |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58795 58795] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15606 C15606] |
| − | {{#set: | + | * HMDB : HMDB12134 |
| − | {{#set: | + | {{#set: smiles=CSCCC(C([O-])=CO)=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M}} |
| + | {{#set: common name=1,2-dihydroxy-5-(methylthio)pent-1-en-3-one}} | ||
| + | {{#set: molecular weight=161.195 }} | ||
| + | {{#set: common name=1,2-dihydroxy-3-keto-5-methylthiopentene anion|1,2-dihydroxy-3-keto-5-methylthiopentane|1,2-dihydroxy-3-keto-5-methylthiopentene|acireductone}} | ||
| + | {{#set: consumed by=R147-RXN}} | ||
Latest revision as of 19:00, 21 March 2018
Contents
Metabolite CPD-85
- smiles:
- CSCCC(C([O-])=CO)=O
- inchi key:
- InChIKey=CILXJJLQPTUUSS-XQRVVYSFSA-M
- common name:
- 1,2-dihydroxy-5-(methylthio)pent-1-en-3-one
- molecular weight:
- 161.195
- Synonym(s):
- 1,2-dihydroxy-3-keto-5-methylthiopentene anion
- 1,2-dihydroxy-3-keto-5-methylthiopentane
- 1,2-dihydroxy-3-keto-5-methylthiopentene
- acireductone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CSCCC(C([O-])=CO)=O" cannot be used as a page name in this wiki.
