Difference between revisions of "Ec-04 001470"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] == * smiles: ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N...")
(Created page with "Category:Gene == Gene Ec-04_001470 == * left end position: ** 1689571 * transcription direction: ** NEGATIVE * right end position: ** 1718654 * centisome position: ** 25.9...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] ==
+
== Gene Ec-04_001470 ==
−
* smiles:
+
* left end position:
−
** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)
+
** 1689571
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 1,2-dihydro-β-NADP
+
** 1718654
−
* molecular weight:
+
* centisome position:
−
** 741.394    
+
** 25.946096    
 
* Synonym(s):
 
* Synonym(s):
−
** 2-dihydro-nicotinamide adenine dinucleotide phosphate
+
** Esi_0015_0164
−
** 2DHNADP
+
** Esi0015_0164
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
−
* [[RXN-16765]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)}}
+
{{#set: left end position=1689571}}
−
{{#set: inchi key=InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: common name=1,2-dihydro-β-NADP}}
+
{{#set: right end position=1718654}}
−
{{#set: molecular weight=741.394   }}
+
{{#set: centisome position=25.946096   }}
−
{{#set: common name=2-dihydro-nicotinamide adenine dinucleotide phosphate|2DHNADP}}
+
{{#set: common name=Esi_0015_0164|Esi0015_0164}}
−
{{#set: produced by=RXN-16765}}
+
{{#set: reaction associated=ATPASE-RXN}}

Latest revision as of 19:02, 21 March 2018

Gene Ec-04_001470

  • left end position:
    • 1689571
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1718654
  • centisome position:
    • 25.946096
  • Synonym(s):
    • Esi_0015_0164
    • Esi0015_0164

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-04_001470&oldid=24004"