Difference between revisions of "ALACAT2-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * smiles: ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ALACAT2-PWY ALACAT2-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ALACAT2-PWY ALACAT2-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
− | * | + | |
* common name: | * common name: | ||
− | ** L- | + | ** L-alanine degradation II (to D-lactate) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''3''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[ALANINE-AMINOTRANSFERASE-RXN]] |
− | * [ | + | ** 1 associated gene(s): |
+ | *** [[Ec-01_011040]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[GLUTAMATE-DEHYDROGENASE-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-12_008040]] | ||
+ | *** [[Ec-06_008240]] | ||
+ | *** [[Ec-06_001980]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=DLACTDEHYDROGNAD-RXN DLACTDEHYDROGNAD-RXN] | ||
== External links == | == External links == | ||
− | + | * LIGAND-MAP: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?MAP00640 MAP00640] | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | * LIGAND- | + | {{#set: taxonomic range=TAX-1239}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=L-alanine degradation II (to D-lactate)}} |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=67.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name=L- | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:02, 21 March 2018
Pathway ALACAT2-PWY
- taxonomic range:
- common name:
- L-alanine degradation II (to D-lactate)
- Synonym(s):
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- ALANINE-AMINOTRANSFERASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- GLUTAMATE-DEHYDROGENASE-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- LIGAND-MAP: