Difference between revisions of "PWY-381"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == * smiles: ** C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-]...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-381 PWY-381] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-381 PWY-381] ==
−
* smiles:
+
* taxonomic range:
−
** C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763]
−
** InChIKey=CIPFCGZLFXVXBG-CNWJWELYSA-F
+
 
* common name:
 
* common name:
−
** D-myo-inositol (1,3,4,5)-tetrakisphosphate
+
** nitrate reduction II (assimilatory)
−
* molecular weight:
+
−
** 492.013   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Ins(1,3,4,5)P4
+
** nitrate assimilation
−
** inositol (1,3,4,5)-tetrakisphosphate
+
−
** 1D-myo-inositol (1,3,4,5)-tetrakisphosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''3''' reactions in the full pathway
−
* [[2.7.1.139-RXN]]
+
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
−
* [[2.7.1.127-RXN]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-01_002720]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[GLUTAMINESYN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-15_004120]]
 +
*** [[Ec-15_004110]]
 +
*** [[Ec-09_000640]]
 +
*** [[Ec-21_003610]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[NITRATE-REDUCTASE-NADH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-10_005740]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01272 C01272]
+
{{#set: taxonomic range=TAX-2763}}
−
* CHEBI:
+
{{#set: common name=nitrate reduction II (assimilatory)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57895 57895]
+
{{#set: common name=nitrate assimilation}}
−
* METABOLIGHTS : MTBLC57895
+
{{#set: reaction found=3}}
−
* PUBCHEM:
+
{{#set: total reaction=3}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24742076 24742076]
+
{{#set: completion rate=100.0}}
−
* HMDB : HMDB01059
+
−
{{#set: smiles=C1(O)(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)}}
+
−
{{#set: inchi key=InChIKey=CIPFCGZLFXVXBG-CNWJWELYSA-F}}
+
−
{{#set: common name=D-myo-inositol (1,3,4,5)-tetrakisphosphate}}
+
−
{{#set: molecular weight=492.013    }}
+
−
{{#set: common name=Ins(1,3,4,5)P4|inositol (1,3,4,5)-tetrakisphosphate|1D-myo-inositol (1,3,4,5)-tetrakisphosphate}}
+
−
{{#set: produced by=2.7.1.139-RXN|2.7.1.127-RXN}}
+

Latest revision as of 19:02, 21 March 2018

Pathway PWY-381

  • taxonomic range:
  • common name:
    • nitrate reduction II (assimilatory)
  • Synonym(s):
    • nitrate assimilation

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-381&oldid=24026"