Difference between revisions of "Charged-PHE-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15619 CPD-15619] == * smiles: ** CC(C(O)C(O)C([CH]=O)O)O * inchi key: ** InChIKey=PNNNRSAQS...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-PHE-tRNAs Charged-PHE-tRNAs] == * common name: ** an L-phenylalanyl-[tRNAphe] * Synonym...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15619 CPD-15619] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-PHE-tRNAs Charged-PHE-tRNAs] ==
* smiles:
+
** CC(C(O)C(O)C([CH]=O)O)O
+
* inchi key:
+
** InChIKey=PNNNRSAQSRJVSB-KCDKBNATSA-N
+
 
* common name:
 
* common name:
** aldehydo-L-fucose
+
** an L-phenylalanyl-[tRNAphe]
* molecular weight:
+
** 164.158   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-14813]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an L-phenylalanyl-[tRNAphe]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3034656 3034656]
+
{{#set: produced by=PHENYLALANINE--TRNA-LIGASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48204 48204]
+
{{#set: smiles=CC(C(O)C(O)C([CH]=O)O)O}}
+
{{#set: inchi key=InChIKey=PNNNRSAQSRJVSB-KCDKBNATSA-N}}
+
{{#set: common name=aldehydo-L-fucose}}
+
{{#set: molecular weight=164.158    }}
+
{{#set: reversible reaction associated=RXN-14813}}
+

Latest revision as of 19:02, 21 March 2018

Metabolite Charged-PHE-tRNAs

  • common name:
    • an L-phenylalanyl-[tRNAphe]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an L-phenylalanyl-[tRNAphe" cannot be used as a page name in this wiki.